About 4-methylsulfonyl-N-[[(2R,3R)-2-propan-2-yloxolan-3-yl]methyl]aniline
4-methylsulfonyl-N-[[(2R,3R)-2-propan-2-yloxolan-3-yl]methyl]aniline (PubChem CID 126799474) has the molecular formula C15H23NO3S
and a molecular weight of 297.42 g/mol. Its IUPAC name is 4-methylsulfonyl-N-[[(2R,3R)-2-propan-2-yloxolan-3-yl]methyl]aniline.
Molecular Properties
| Compound Name | 4-methylsulfonyl-N-[[(2R,3R)-2-propan-2-yloxolan-3-yl]methyl]aniline |
| PubChem CID | 126799474 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 4-methylsulfonyl-N-[[(2R,3R)-2-propan-2-yloxolan-3-yl]methyl]aniline |
| SMILES | CC(C)[C@H]1OCC[C@@H]1CNc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H23NO3S/c1-11(2)15-12(8-9-19-15)10-16-13-4-6-14(7-5-13)20(3,17)18/h4-7,11-12,15-16H,8-10H2,1-3H3/t12-,15-/m1/s1 |
| InChIKey | XWKQMSSIKDZCII-IUODEOHRSA-N |
| XLogP | 2.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methylsulfonyl-N-[[(2R,3R)-2-propan-2-yloxolan-3-yl]methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfonyl-N-[[(2R,3R)-2-propan-2-yloxolan-3-yl]methyl]aniline?
The IUPAC name of 4-methylsulfonyl-N-[[(2R,3R)-2-propan-2-yloxolan-3-yl]methyl]aniline (CID 126799474) is 4-methylsulfonyl-N-[[(2R,3R)-2-propan-2-yloxolan-3-yl]methyl]aniline.
What is the SMILES notation for 4-methylsulfonyl-N-[[(2R,3R)-2-propan-2-yloxolan-3-yl]methyl]aniline?
The canonical SMILES for 4-methylsulfonyl-N-[[(2R,3R)-2-propan-2-yloxolan-3-yl]methyl]aniline is CC(C)[C@H]1OCC[C@@H]1CNc1ccc(S(C)(=O)=O)cc1.
What is the InChIKey of 4-methylsulfonyl-N-[[(2R,3R)-2-propan-2-yloxolan-3-yl]methyl]aniline?
The InChIKey is XWKQMSSIKDZCII-IUODEOHRSA-N. The full InChI is InChI=1S/C15H23NO3S/c1-11(2)15-12(8-9-19-15)10-16-13-4-6-14(7-5-13)20(3,17)18/h4-7,11-12,15-16H,8-10H2,1-3H3/t12-,15-/m1/s1.
What are the key properties of 4-methylsulfonyl-N-[[(2R,3R)-2-propan-2-yloxolan-3-yl]methyl]aniline?
4-methylsulfonyl-N-[[(2R,3R)-2-propan-2-yloxolan-3-yl]methyl]aniline has a molecular weight of 297.42 g/mol, XLogP of 2.56, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfonyl-N-[[(2R,3R)-2-propan-2-yloxolan-3-yl]methyl]aniline is sourced from PubChem (CID 126799474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).