About (2,3-dimethylphenyl)-[(2S,4S)-4-(hydroxymethyl)-2-methylpiperidin-1-yl]methanone
(2,3-dimethylphenyl)-[(2S,4S)-4-(hydroxymethyl)-2-methylpiperidin-1-yl]methanone (PubChem CID 126799939) has the molecular formula C16H23NO2
and a molecular weight of 261.37 g/mol. Its IUPAC name is (2,3-dimethylphenyl)-[(2S,4S)-4-(hydroxymethyl)-2-methylpiperidin-1-yl]methanone.
Molecular Properties
| Compound Name | (2,3-dimethylphenyl)-[(2S,4S)-4-(hydroxymethyl)-2-methylpiperidin-1-yl]methanone |
| PubChem CID | 126799939 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (2,3-dimethylphenyl)-[(2S,4S)-4-(hydroxymethyl)-2-methylpiperidin-1-yl]methanone |
| SMILES | Cc1cccc(C(=O)N2CC[C@H](CO)C[C@@H]2C)c1C |
| InChI | InChI=1S/C16H23NO2/c1-11-5-4-6-15(13(11)3)16(19)17-8-7-14(10-18)9-12(17)2/h4-6,12,14,18H,7-10H2,1-3H3/t12-,14-/m0/s1 |
| InChIKey | XGHUOYGAOWJDJC-JSGCOSHPSA-N |
| XLogP | 2.54 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2,3-dimethylphenyl)-[(2S,4S)-4-(hydroxymethyl)-2-methylpiperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dimethylphenyl)-[(2S,4S)-4-(hydroxymethyl)-2-methylpiperidin-1-yl]methanone?
The IUPAC name of (2,3-dimethylphenyl)-[(2S,4S)-4-(hydroxymethyl)-2-methylpiperidin-1-yl]methanone (CID 126799939) is (2,3-dimethylphenyl)-[(2S,4S)-4-(hydroxymethyl)-2-methylpiperidin-1-yl]methanone.
What is the SMILES notation for (2,3-dimethylphenyl)-[(2S,4S)-4-(hydroxymethyl)-2-methylpiperidin-1-yl]methanone?
The canonical SMILES for (2,3-dimethylphenyl)-[(2S,4S)-4-(hydroxymethyl)-2-methylpiperidin-1-yl]methanone is Cc1cccc(C(=O)N2CC[C@H](CO)C[C@@H]2C)c1C.
What is the InChIKey of (2,3-dimethylphenyl)-[(2S,4S)-4-(hydroxymethyl)-2-methylpiperidin-1-yl]methanone?
The InChIKey is XGHUOYGAOWJDJC-JSGCOSHPSA-N. The full InChI is InChI=1S/C16H23NO2/c1-11-5-4-6-15(13(11)3)16(19)17-8-7-14(10-18)9-12(17)2/h4-6,12,14,18H,7-10H2,1-3H3/t12-,14-/m0/s1.
What are the key properties of (2,3-dimethylphenyl)-[(2S,4S)-4-(hydroxymethyl)-2-methylpiperidin-1-yl]methanone?
(2,3-dimethylphenyl)-[(2S,4S)-4-(hydroxymethyl)-2-methylpiperidin-1-yl]methanone has a molecular weight of 261.37 g/mol, XLogP of 2.54, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dimethylphenyl)-[(2S,4S)-4-(hydroxymethyl)-2-methylpiperidin-1-yl]methanone is sourced from PubChem (CID 126799939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).