About N'-methyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine;dihydrochloride
N'-methyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine;dihydrochloride (PubChem CID 126800681) has the molecular formula C6H18Cl2N2O2S
and a molecular weight of 253.19 g/mol. Its IUPAC name is N'-methyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine;dihydrochloride.
Molecular Properties
| Compound Name | N'-methyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine;dihydrochloride |
| PubChem CID | 126800681 |
| Molecular Formula | C6H18Cl2N2O2S |
| Molecular Weight | 253.19 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | N'-methyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine;dihydrochloride |
| SMILES | CN(CCN)CCS(C)(=O)=O.Cl.Cl |
| InChI | InChI=1S/C6H16N2O2S.2ClH/c1-8(4-3-7)5-6-11(2,9)10;;/h3-7H2,1-2H3;2*1H |
| InChIKey | CQJYPKSWSLSACT-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.19 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-methyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine;dihydrochloride?
The IUPAC name of N'-methyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine;dihydrochloride (CID 126800681) is N'-methyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine;dihydrochloride.
What is the SMILES notation for N'-methyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine;dihydrochloride?
The canonical SMILES for N'-methyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine;dihydrochloride is CN(CCN)CCS(C)(=O)=O.Cl.Cl.
What is the InChIKey of N'-methyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine;dihydrochloride?
The InChIKey is CQJYPKSWSLSACT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2O2S.2ClH/c1-8(4-3-7)5-6-11(2,9)10;;/h3-7H2,1-2H3;2*1H.
What are the key properties of N'-methyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine;dihydrochloride?
N'-methyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine;dihydrochloride has a molecular weight of 253.19 g/mol, XLogP of -0.23, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine;dihydrochloride is sourced from PubChem (CID 126800681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).