About 4-(4-chlorophenyl)-1-(1,8-dioxa-4-azaspiro[5.5]undecan-4-yl)-3,3-dimethylbutan-1-one
4-(4-chlorophenyl)-1-(1,8-dioxa-4-azaspiro[5.5]undecan-4-yl)-3,3-dimethylbutan-1-one (PubChem CID 126800733) has the molecular formula C20H28ClNO3
and a molecular weight of 365.90 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-(1,8-dioxa-4-azaspiro[5.5]undecan-4-yl)-3,3-dimethylbutan-1-one.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-1-(1,8-dioxa-4-azaspiro[5.5]undecan-4-yl)-3,3-dimethylbutan-1-one |
| PubChem CID | 126800733 |
| Molecular Formula | C20H28ClNO3 |
| Molecular Weight | 365.90 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 4-(4-chlorophenyl)-1-(1,8-dioxa-4-azaspiro[5.5]undecan-4-yl)-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(CC(=O)N1CCOC2(CCCOC2)C1)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H28ClNO3/c1-19(2,12-16-4-6-17(21)7-5-16)13-18(23)22-9-11-25-20(14-22)8-3-10-24-15-20/h4-7H,3,8-15H2,1-2H3 |
| InChIKey | UUSNIGYNHSJSRJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.90 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-chlorophenyl)-1-(1,8-dioxa-4-azaspiro[5.5]undecan-4-yl)-3,3-dimethylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-1-(1,8-dioxa-4-azaspiro[5.5]undecan-4-yl)-3,3-dimethylbutan-1-one?
The IUPAC name of 4-(4-chlorophenyl)-1-(1,8-dioxa-4-azaspiro[5.5]undecan-4-yl)-3,3-dimethylbutan-1-one (CID 126800733) is 4-(4-chlorophenyl)-1-(1,8-dioxa-4-azaspiro[5.5]undecan-4-yl)-3,3-dimethylbutan-1-one.
What is the SMILES notation for 4-(4-chlorophenyl)-1-(1,8-dioxa-4-azaspiro[5.5]undecan-4-yl)-3,3-dimethylbutan-1-one?
The canonical SMILES for 4-(4-chlorophenyl)-1-(1,8-dioxa-4-azaspiro[5.5]undecan-4-yl)-3,3-dimethylbutan-1-one is CC(C)(CC(=O)N1CCOC2(CCCOC2)C1)Cc1ccc(Cl)cc1.
What is the InChIKey of 4-(4-chlorophenyl)-1-(1,8-dioxa-4-azaspiro[5.5]undecan-4-yl)-3,3-dimethylbutan-1-one?
The InChIKey is UUSNIGYNHSJSRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28ClNO3/c1-19(2,12-16-4-6-17(21)7-5-16)13-18(23)22-9-11-25-20(14-22)8-3-10-24-15-20/h4-7H,3,8-15H2,1-2H3.
What are the key properties of 4-(4-chlorophenyl)-1-(1,8-dioxa-4-azaspiro[5.5]undecan-4-yl)-3,3-dimethylbutan-1-one?
4-(4-chlorophenyl)-1-(1,8-dioxa-4-azaspiro[5.5]undecan-4-yl)-3,3-dimethylbutan-1-one has a molecular weight of 365.90 g/mol, XLogP of 3.71, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-1-(1,8-dioxa-4-azaspiro[5.5]undecan-4-yl)-3,3-dimethylbutan-1-one is sourced from PubChem (CID 126800733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).