About N-pyridin-2-yl-4-(2,2,2-trifluoroethyl)morpholine-3-carboxamide
N-pyridin-2-yl-4-(2,2,2-trifluoroethyl)morpholine-3-carboxamide (PubChem CID 126801081) has the molecular formula C12H14F3N3O2
and a molecular weight of 289.26 g/mol. Its IUPAC name is N-pyridin-2-yl-4-(2,2,2-trifluoroethyl)morpholine-3-carboxamide.
Molecular Properties
| Compound Name | N-pyridin-2-yl-4-(2,2,2-trifluoroethyl)morpholine-3-carboxamide |
| PubChem CID | 126801081 |
| Molecular Formula | C12H14F3N3O2 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-pyridin-2-yl-4-(2,2,2-trifluoroethyl)morpholine-3-carboxamide |
| SMILES | O=C(Nc1ccccn1)C1COCCN1CC(F)(F)F |
| InChI | InChI=1S/C12H14F3N3O2/c13-12(14,15)8-18-5-6-20-7-9(18)11(19)17-10-3-1-2-4-16-10/h1-4,9H,5-8H2,(H,16,17,19) |
| InChIKey | BSKPDNUCZJTPAN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-pyridin-2-yl-4-(2,2,2-trifluoroethyl)morpholine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyridin-2-yl-4-(2,2,2-trifluoroethyl)morpholine-3-carboxamide?
The IUPAC name of N-pyridin-2-yl-4-(2,2,2-trifluoroethyl)morpholine-3-carboxamide (CID 126801081) is N-pyridin-2-yl-4-(2,2,2-trifluoroethyl)morpholine-3-carboxamide.
What is the SMILES notation for N-pyridin-2-yl-4-(2,2,2-trifluoroethyl)morpholine-3-carboxamide?
The canonical SMILES for N-pyridin-2-yl-4-(2,2,2-trifluoroethyl)morpholine-3-carboxamide is O=C(Nc1ccccn1)C1COCCN1CC(F)(F)F.
What is the InChIKey of N-pyridin-2-yl-4-(2,2,2-trifluoroethyl)morpholine-3-carboxamide?
The InChIKey is BSKPDNUCZJTPAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F3N3O2/c13-12(14,15)8-18-5-6-20-7-9(18)11(19)17-10-3-1-2-4-16-10/h1-4,9H,5-8H2,(H,16,17,19).
What are the key properties of N-pyridin-2-yl-4-(2,2,2-trifluoroethyl)morpholine-3-carboxamide?
N-pyridin-2-yl-4-(2,2,2-trifluoroethyl)morpholine-3-carboxamide has a molecular weight of 289.26 g/mol, XLogP of 1.28, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyridin-2-yl-4-(2,2,2-trifluoroethyl)morpholine-3-carboxamide is sourced from PubChem (CID 126801081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).