C19H23N3O3 — CID 126801820
(2R,5S)-N-[5-(oxan-4-yl)-1H-pyrazol-3-yl]-5-phenyloxolane-2-carboxamide (PubChem CID 126801820) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is (2R,5S)-N-[5-(oxan-4-yl)-1H-pyrazol-3-yl]-5-phenyloxolane-2-carboxamide.
| Compound Name | (2R,5S)-N-[5-(oxan-4-yl)-1H-pyrazol-3-yl]-5-phenyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 126801820 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | (2R,5S)-N-[5-(oxan-4-yl)-1H-pyrazol-3-yl]-5-phenyloxolane-2-carboxamide |
| SMILES | O=C(Nc1cc(C2CCOCC2)[nH]n1)[C@H]1CC[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C19H23N3O3/c23-19(17-7-6-16(25-17)14-4-2-1-3-5-14)20-18-12-15(21-22-18)13-8-10-24-11-9-13/h1-5,12-13,16-17H,6-11H2,(H2,20,21,22,23)/t16-,17+/m0/s1 |
| InChIKey | TZBSAIOLXFIOHE-DLBZAZTESA-N |
| XLogP | 3.16 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |