C15H19N3O2S2 — CID 126802053
N-(5-methyl-6-piperidin-1-yl-3-pyridinyl)thiophene-3-sulfonamide (PubChem CID 126802053) has the molecular formula C15H19N3O2S2 and a molecular weight of 337.47 g/mol. Its IUPAC name is N-(5-methyl-6-piperidin-1-yl-3-pyridinyl)thiophene-3-sulfonamide.
| Compound Name | N-(5-methyl-6-piperidin-1-yl-3-pyridinyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 126802053 |
| Molecular Formula | C15H19N3O2S2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | N-(5-methyl-6-piperidin-1-yl-3-pyridinyl)thiophene-3-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccsc2)cnc1N1CCCCC1 |
| InChI | InChI=1S/C15H19N3O2S2/c1-12-9-13(17-22(19,20)14-5-8-21-11-14)10-16-15(12)18-6-3-2-4-7-18/h5,8-11,17H,2-4,6-7H2,1H3 |
| InChIKey | VFNUYPMMCWLYBB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |