C26H26N4O5 — CID 126802759
5-[[3-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methylidene]-2-oxo-5-phenylcyclohexylidene]methyl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 126802759) has the molecular formula C26H26N4O5 and a molecular weight of 474.52 g/mol. Its IUPAC name is 5-[[3-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methylidene]-2-oxo-5-phenylcyclohexylidene]methyl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 5-[[3-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methylidene]-2-oxo-5-phenylcyclohexylidene]methyl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 126802759 |
| Molecular Formula | C26H26N4O5 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 5-[[3-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methylidene]-2-oxo-5-phenylcyclohexylidene]methyl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cn1cc(C=C2CC(c3ccccc3)CC(=Cc3cn(C)c(=O)n(C)c3=O)C2=O)c(=O)n(C)c1=O |
| InChI | InChI=1S/C26H26N4O5/c1-27-14-20(23(32)29(3)25(27)34)12-18-10-17(16-8-6-5-7-9-16)11-19(22(18)31)13-21-15-28(2)26(35)30(4)24(21)33/h5-9,12-15,17H,10-11H2,1-4H3 |
| InChIKey | DXXZFTUOHIPYRP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 105.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|