About (2,2-difluoromorpholin-4-yl)-(5-methyl-1,2-thiazol-3-yl)methanone
(2,2-difluoromorpholin-4-yl)-(5-methyl-1,2-thiazol-3-yl)methanone (PubChem CID 126802968) has the molecular formula C9H10F2N2O2S
and a molecular weight of 248.25 g/mol. Its IUPAC name is (2,2-difluoromorpholin-4-yl)-(5-methyl-1,2-thiazol-3-yl)methanone.
Molecular Properties
| Compound Name | (2,2-difluoromorpholin-4-yl)-(5-methyl-1,2-thiazol-3-yl)methanone |
| PubChem CID | 126802968 |
| Molecular Formula | C9H10F2N2O2S |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | (2,2-difluoromorpholin-4-yl)-(5-methyl-1,2-thiazol-3-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCOC(F)(F)C2)ns1 |
| InChI | InChI=1S/C9H10F2N2O2S/c1-6-4-7(12-16-6)8(14)13-2-3-15-9(10,11)5-13/h4H,2-3,5H2,1H3 |
| InChIKey | IHHVBHWSENBZNA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2,2-difluoromorpholin-4-yl)-(5-methyl-1,2-thiazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-difluoromorpholin-4-yl)-(5-methyl-1,2-thiazol-3-yl)methanone?
The IUPAC name of (2,2-difluoromorpholin-4-yl)-(5-methyl-1,2-thiazol-3-yl)methanone (CID 126802968) is (2,2-difluoromorpholin-4-yl)-(5-methyl-1,2-thiazol-3-yl)methanone.
What is the SMILES notation for (2,2-difluoromorpholin-4-yl)-(5-methyl-1,2-thiazol-3-yl)methanone?
The canonical SMILES for (2,2-difluoromorpholin-4-yl)-(5-methyl-1,2-thiazol-3-yl)methanone is Cc1cc(C(=O)N2CCOC(F)(F)C2)ns1.
What is the InChIKey of (2,2-difluoromorpholin-4-yl)-(5-methyl-1,2-thiazol-3-yl)methanone?
The InChIKey is IHHVBHWSENBZNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F2N2O2S/c1-6-4-7(12-16-6)8(14)13-2-3-15-9(10,11)5-13/h4H,2-3,5H2,1H3.
What are the key properties of (2,2-difluoromorpholin-4-yl)-(5-methyl-1,2-thiazol-3-yl)methanone?
(2,2-difluoromorpholin-4-yl)-(5-methyl-1,2-thiazol-3-yl)methanone has a molecular weight of 248.25 g/mol, XLogP of 1.52, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-difluoromorpholin-4-yl)-(5-methyl-1,2-thiazol-3-yl)methanone is sourced from PubChem (CID 126802968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).