C14H24N4O2S — CID 126803338
2-(2,2-dimethylmorpholin-4-yl)-N'-[(2,4-dimethyl-1,3-thiazol-5-yl)methoxy]ethanimidamide (PubChem CID 126803338) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is 2-(2,2-dimethylmorpholin-4-yl)-N'-[(2,4-dimethyl-1,3-thiazol-5-yl)methoxy]ethanimidamide.
| Compound Name | 2-(2,2-dimethylmorpholin-4-yl)-N'-[(2,4-dimethyl-1,3-thiazol-5-yl)methoxy]ethanimidamide |
|---|---|
| PubChem CID | 126803338 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-(2,2-dimethylmorpholin-4-yl)-N'-[(2,4-dimethyl-1,3-thiazol-5-yl)methoxy]ethanimidamide |
| SMILES | Cc1nc(C)c(CON=C(N)CN2CCOC(C)(C)C2)s1 |
| InChI | InChI=1S/C14H24N4O2S/c1-10-12(21-11(2)16-10)8-20-17-13(15)7-18-5-6-19-14(3,4)9-18/h5-9H2,1-4H3,(H2,15,17) |
| InChIKey | JKBPMXNBKFNFHD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|