C18H30N4O2 — CID 126803798
2-(dimethylamino)-N-[2-[[2-(dimethylamino)acetyl]amino]-3-phenylbutyl]acetamide (PubChem CID 126803798) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[2-[[2-(dimethylamino)acetyl]amino]-3-phenylbutyl]acetamide.
| Compound Name | 2-(dimethylamino)-N-[2-[[2-(dimethylamino)acetyl]amino]-3-phenylbutyl]acetamide |
|---|---|
| PubChem CID | 126803798 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | 2-(dimethylamino)-N-[2-[[2-(dimethylamino)acetyl]amino]-3-phenylbutyl]acetamide |
| SMILES | CC(c1ccccc1)C(CNC(=O)CN(C)C)NC(=O)CN(C)C |
| InChI | InChI=1S/C18H30N4O2/c1-14(15-9-7-6-8-10-15)16(20-18(24)13-22(4)5)11-19-17(23)12-21(2)3/h6-10,14,16H,11-13H2,1-5H3,(H,19,23)(H,20,24) |
| InChIKey | XPGLFSCGXBDXBC-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |