C10H19N — CID 1268041
(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane (PubChem CID 1268041) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is (1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane.
| Compound Name | (1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 1268041 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | (1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane |
| SMILES | CC1(C)C[C@@H]2C[C@@](C)(CN2)C1 |
| InChI | InChI=1S/C10H19N/c1-9(2)4-8-5-10(3,6-9)7-11-8/h8,11H,4-7H2,1-3H3/t8-,10-/m1/s1 |
| InChIKey | FRAKHUZTNLUGPB-PSASIEDQSA-N |
| XLogP | 2.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |