About N-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1-(oxolan-3-yl)ethanamine
N-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1-(oxolan-3-yl)ethanamine (PubChem CID 126804138) has the molecular formula C14H17BrN2O2
and a molecular weight of 325.21 g/mol. Its IUPAC name is N-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1-(oxolan-3-yl)ethanamine.
Molecular Properties
| Compound Name | N-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1-(oxolan-3-yl)ethanamine |
| PubChem CID | 126804138 |
| Molecular Formula | C14H17BrN2O2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | N-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1-(oxolan-3-yl)ethanamine |
| SMILES | CC(NCc1nc2ccc(Br)cc2o1)C1CCOC1 |
| InChI | InChI=1S/C14H17BrN2O2/c1-9(10-4-5-18-8-10)16-7-14-17-12-3-2-11(15)6-13(12)19-14/h2-3,6,9-10,16H,4-5,7-8H2,1H3 |
| InChIKey | RZBDZCGFKWRWHS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1-(oxolan-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1-(oxolan-3-yl)ethanamine?
The IUPAC name of N-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1-(oxolan-3-yl)ethanamine (CID 126804138) is N-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1-(oxolan-3-yl)ethanamine.
What is the SMILES notation for N-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1-(oxolan-3-yl)ethanamine?
The canonical SMILES for N-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1-(oxolan-3-yl)ethanamine is CC(NCc1nc2ccc(Br)cc2o1)C1CCOC1.
What is the InChIKey of N-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1-(oxolan-3-yl)ethanamine?
The InChIKey is RZBDZCGFKWRWHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17BrN2O2/c1-9(10-4-5-18-8-10)16-7-14-17-12-3-2-11(15)6-13(12)19-14/h2-3,6,9-10,16H,4-5,7-8H2,1H3.
What are the key properties of N-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1-(oxolan-3-yl)ethanamine?
N-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1-(oxolan-3-yl)ethanamine has a molecular weight of 325.21 g/mol, XLogP of 3.10, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1-(oxolan-3-yl)ethanamine is sourced from PubChem (CID 126804138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).