About 2,2-dimethyl-N-[(1-propan-2-yltriazol-4-yl)methyl]-3,4-dihydrochromen-4-amine
2,2-dimethyl-N-[(1-propan-2-yltriazol-4-yl)methyl]-3,4-dihydrochromen-4-amine (PubChem CID 126804261) has the molecular formula C17H24N4O
and a molecular weight of 300.41 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(1-propan-2-yltriazol-4-yl)methyl]-3,4-dihydrochromen-4-amine.
Molecular Properties
| Compound Name | 2,2-dimethyl-N-[(1-propan-2-yltriazol-4-yl)methyl]-3,4-dihydrochromen-4-amine |
| PubChem CID | 126804261 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 2,2-dimethyl-N-[(1-propan-2-yltriazol-4-yl)methyl]-3,4-dihydrochromen-4-amine |
| SMILES | CC(C)n1cc(CNC2CC(C)(C)Oc3ccccc32)nn1 |
| InChI | InChI=1S/C17H24N4O/c1-12(2)21-11-13(19-20-21)10-18-15-9-17(3,4)22-16-8-6-5-7-14(15)16/h5-8,11-12,15,18H,9-10H2,1-4H3 |
| InChIKey | LBFWUSHVMGPXOF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,2-dimethyl-N-[(1-propan-2-yltriazol-4-yl)methyl]-3,4-dihydrochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-N-[(1-propan-2-yltriazol-4-yl)methyl]-3,4-dihydrochromen-4-amine?
The IUPAC name of 2,2-dimethyl-N-[(1-propan-2-yltriazol-4-yl)methyl]-3,4-dihydrochromen-4-amine (CID 126804261) is 2,2-dimethyl-N-[(1-propan-2-yltriazol-4-yl)methyl]-3,4-dihydrochromen-4-amine.
What is the SMILES notation for 2,2-dimethyl-N-[(1-propan-2-yltriazol-4-yl)methyl]-3,4-dihydrochromen-4-amine?
The canonical SMILES for 2,2-dimethyl-N-[(1-propan-2-yltriazol-4-yl)methyl]-3,4-dihydrochromen-4-amine is CC(C)n1cc(CNC2CC(C)(C)Oc3ccccc32)nn1.
What is the InChIKey of 2,2-dimethyl-N-[(1-propan-2-yltriazol-4-yl)methyl]-3,4-dihydrochromen-4-amine?
The InChIKey is LBFWUSHVMGPXOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4O/c1-12(2)21-11-13(19-20-21)10-18-15-9-17(3,4)22-16-8-6-5-7-14(15)16/h5-8,11-12,15,18H,9-10H2,1-4H3.
What are the key properties of 2,2-dimethyl-N-[(1-propan-2-yltriazol-4-yl)methyl]-3,4-dihydrochromen-4-amine?
2,2-dimethyl-N-[(1-propan-2-yltriazol-4-yl)methyl]-3,4-dihydrochromen-4-amine has a molecular weight of 300.41 g/mol, XLogP of 3.25, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-N-[(1-propan-2-yltriazol-4-yl)methyl]-3,4-dihydrochromen-4-amine is sourced from PubChem (CID 126804261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).