About 2-[2-(3-methyl-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-2-oxoethyl]-6-phenylpyridazin-3-one
2-[2-(3-methyl-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-2-oxoethyl]-6-phenylpyridazin-3-one (PubChem CID 126804717) has the molecular formula C22H21N3O2S
and a molecular weight of 391.50 g/mol. Its IUPAC name is 2-[2-(3-methyl-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-2-oxoethyl]-6-phenylpyridazin-3-one.
Molecular Properties
| Compound Name | 2-[2-(3-methyl-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-2-oxoethyl]-6-phenylpyridazin-3-one |
| PubChem CID | 126804717 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-[2-(3-methyl-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-2-oxoethyl]-6-phenylpyridazin-3-one |
| SMILES | CC1CSc2ccccc2CN1C(=O)Cn1nc(-c2ccccc2)ccc1=O |
| InChI | InChI=1S/C22H21N3O2S/c1-16-15-28-20-10-6-5-9-18(20)13-24(16)22(27)14-25-21(26)12-11-19(23-25)17-7-3-2-4-8-17/h2-12,16H,13-15H2,1H3 |
| InChIKey | KMMGTEFWQYJMSZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-(3-methyl-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-2-oxoethyl]-6-phenylpyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3-methyl-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-2-oxoethyl]-6-phenylpyridazin-3-one?
The IUPAC name of 2-[2-(3-methyl-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-2-oxoethyl]-6-phenylpyridazin-3-one (CID 126804717) is 2-[2-(3-methyl-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-2-oxoethyl]-6-phenylpyridazin-3-one.
What is the SMILES notation for 2-[2-(3-methyl-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-2-oxoethyl]-6-phenylpyridazin-3-one?
The canonical SMILES for 2-[2-(3-methyl-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-2-oxoethyl]-6-phenylpyridazin-3-one is CC1CSc2ccccc2CN1C(=O)Cn1nc(-c2ccccc2)ccc1=O.
What is the InChIKey of 2-[2-(3-methyl-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-2-oxoethyl]-6-phenylpyridazin-3-one?
The InChIKey is KMMGTEFWQYJMSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O2S/c1-16-15-28-20-10-6-5-9-18(20)13-24(16)22(27)14-25-21(26)12-11-19(23-25)17-7-3-2-4-8-17/h2-12,16H,13-15H2,1H3.
What are the key properties of 2-[2-(3-methyl-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-2-oxoethyl]-6-phenylpyridazin-3-one?
2-[2-(3-methyl-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-2-oxoethyl]-6-phenylpyridazin-3-one has a molecular weight of 391.50 g/mol, XLogP of 3.43, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3-methyl-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-2-oxoethyl]-6-phenylpyridazin-3-one is sourced from PubChem (CID 126804717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).