C15H13N3O3 — CID 126805171
2-methyl-3-oxo-N-pyridin-4-yl-4H-1,4-benzoxazine-8-carboxamide (PubChem CID 126805171) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is 2-methyl-3-oxo-N-pyridin-4-yl-4H-1,4-benzoxazine-8-carboxamide.
| Compound Name | 2-methyl-3-oxo-N-pyridin-4-yl-4H-1,4-benzoxazine-8-carboxamide |
|---|---|
| PubChem CID | 126805171 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-methyl-3-oxo-N-pyridin-4-yl-4H-1,4-benzoxazine-8-carboxamide |
| SMILES | CC1Oc2c(cccc2C(=O)Nc2ccncc2)NC1=O |
| InChI | InChI=1S/C15H13N3O3/c1-9-14(19)18-12-4-2-3-11(13(12)21-9)15(20)17-10-5-7-16-8-6-10/h2-9H,1H3,(H,18,19)(H,16,17,20) |
| InChIKey | MYMUJJUDJAJMKR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |