C16H23NO4S — CID 126805891
(4-hydroxy-4-propylpiperidin-1-yl)-(2-methylsulfonylphenyl)methanone (PubChem CID 126805891) has the molecular formula C16H23NO4S and a molecular weight of 325.43 g/mol. Its IUPAC name is (4-hydroxy-4-propylpiperidin-1-yl)-(2-methylsulfonylphenyl)methanone.
| Compound Name | (4-hydroxy-4-propylpiperidin-1-yl)-(2-methylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 126805891 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (4-hydroxy-4-propylpiperidin-1-yl)-(2-methylsulfonylphenyl)methanone |
| SMILES | CCCC1(O)CCN(C(=O)c2ccccc2S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C16H23NO4S/c1-3-8-16(19)9-11-17(12-10-16)15(18)13-6-4-5-7-14(13)22(2,20)21/h4-7,19H,3,8-12H2,1-2H3 |
| InChIKey | HHIIAOHGYPHVJW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |