C11H19N3O2 — CID 1268066
7,7,9,9-tetramethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 1268066) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is 7,7,9,9-tetramethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 7,7,9,9-tetramethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 1268066 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 7,7,9,9-tetramethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1(C)CC2(CC(C)(C)N1)NC(=O)NC2=O |
| InChI | InChI=1S/C11H19N3O2/c1-9(2)5-11(6-10(3,4)14-9)7(15)12-8(16)13-11/h14H,5-6H2,1-4H3,(H2,12,13,15,16) |
| InChIKey | PNJCQCUNRRANAF-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|