C12H16F3N5O3 — CID 126806740
(2R,5S)-2-N,2-N-dimethyl-5-N-[[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]oxolane-2,5-dicarboxamide (PubChem CID 126806740) has the molecular formula C12H16F3N5O3 and a molecular weight of 335.29 g/mol. Its IUPAC name is (2R,5S)-2-N,2-N-dimethyl-5-N-[[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]oxolane-2,5-dicarboxamide.
| Compound Name | (2R,5S)-2-N,2-N-dimethyl-5-N-[[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]oxolane-2,5-dicarboxamide |
|---|---|
| PubChem CID | 126806740 |
| Molecular Formula | C12H16F3N5O3 |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | (2R,5S)-2-N,2-N-dimethyl-5-N-[[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]oxolane-2,5-dicarboxamide |
| SMILES | CN(C)C(=O)[C@H]1CC[C@@H](C(=O)NCc2nc(C(F)(F)F)n[nH]2)O1 |
| InChI | InChI=1S/C12H16F3N5O3/c1-20(2)10(22)7-4-3-6(23-7)9(21)16-5-8-17-11(19-18-8)12(13,14)15/h6-7H,3-5H2,1-2H3,(H,16,21)(H,17,18,19)/t6-,7+/m0/s1 |
| InChIKey | KTCIDAMAWQWUFR-NKWVEPMBSA-N |
| XLogP | 0.08 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |