About 6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine;dihydrochloride
6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine;dihydrochloride (PubChem CID 126806755) has the molecular formula C6H9Cl2N3
and a molecular weight of 194.06 g/mol. Its IUPAC name is 6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine;dihydrochloride.
Molecular Properties
| Compound Name | 6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine;dihydrochloride |
| PubChem CID | 126806755 |
| Molecular Formula | C6H9Cl2N3 |
| Molecular Weight | 194.06 g/mol |
| Exact Mass | 193.02 |
| IUPAC Name | 6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine;dihydrochloride |
| SMILES | Cl.Cl.c1ncc2c(n1)NCC2 |
| InChI | InChI=1S/C6H7N3.2ClH/c1-2-8-6-5(1)3-7-4-9-6;;/h3-4H,1-2H2,(H,7,8,9);2*1H |
| InChIKey | GQCJFWLRLOHRHP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.06 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine;dihydrochloride?
The IUPAC name of 6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine;dihydrochloride (CID 126806755) is 6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine;dihydrochloride.
What is the SMILES notation for 6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine;dihydrochloride?
The canonical SMILES for 6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine;dihydrochloride is Cl.Cl.c1ncc2c(n1)NCC2.
What is the InChIKey of 6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine;dihydrochloride?
The InChIKey is GQCJFWLRLOHRHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3.2ClH/c1-2-8-6-5(1)3-7-4-9-6;;/h3-4H,1-2H2,(H,7,8,9);2*1H.
What are the key properties of 6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine;dihydrochloride?
6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine;dihydrochloride has a molecular weight of 194.06 g/mol, XLogP of 1.29, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine;dihydrochloride is sourced from PubChem (CID 126806755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).