C14H16F3N3O3 — CID 126806850
methyl 2-(3-carbamoylpiperidin-1-yl)-6-(trifluoromethyl)pyridine-3-carboxylate (PubChem CID 126806850) has the molecular formula C14H16F3N3O3 and a molecular weight of 331.29 g/mol. Its IUPAC name is methyl 2-(3-carbamoylpiperidin-1-yl)-6-(trifluoromethyl)pyridine-3-carboxylate.
| Compound Name | methyl 2-(3-carbamoylpiperidin-1-yl)-6-(trifluoromethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 126806850 |
| Molecular Formula | C14H16F3N3O3 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | methyl 2-(3-carbamoylpiperidin-1-yl)-6-(trifluoromethyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(C(F)(F)F)nc1N1CCCC(C(N)=O)C1 |
| InChI | InChI=1S/C14H16F3N3O3/c1-23-13(22)9-4-5-10(14(15,16)17)19-12(9)20-6-2-3-8(7-20)11(18)21/h4-5,8H,2-3,6-7H2,1H3,(H2,18,21) |
| InChIKey | FFRAYIWDYITSCU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |