C21H21NO3 — CID 126807617
2-(1-benzofuran-3-yl)-N-[(1R,2S)-2-(4-ethoxyphenyl)cyclopropyl]acetamide (PubChem CID 126807617) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-(1-benzofuran-3-yl)-N-[(1R,2S)-2-(4-ethoxyphenyl)cyclopropyl]acetamide.
| Compound Name | 2-(1-benzofuran-3-yl)-N-[(1R,2S)-2-(4-ethoxyphenyl)cyclopropyl]acetamide |
|---|---|
| PubChem CID | 126807617 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-(1-benzofuran-3-yl)-N-[(1R,2S)-2-(4-ethoxyphenyl)cyclopropyl]acetamide |
| SMILES | CCOc1ccc([C@@H]2C[C@H]2NC(=O)Cc2coc3ccccc23)cc1 |
| InChI | InChI=1S/C21H21NO3/c1-2-24-16-9-7-14(8-10-16)18-12-19(18)22-21(23)11-15-13-25-20-6-4-3-5-17(15)20/h3-10,13,18-19H,2,11-12H2,1H3,(H,22,23)/t18-,19+/m0/s1 |
| InChIKey | ZBMNIVHDYBKPKA-RBUKOAKNSA-N |
| XLogP | 4.05 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |