About 1-(1,2-thiazol-5-yl)ethanamine;dihydrochloride
1-(1,2-thiazol-5-yl)ethanamine;dihydrochloride (PubChem CID 126807686) has the molecular formula C5H10Cl2N2S
and a molecular weight of 201.12 g/mol. Its IUPAC name is 1-(1,2-thiazol-5-yl)ethanamine;dihydrochloride.
Molecular Properties
| Compound Name | 1-(1,2-thiazol-5-yl)ethanamine;dihydrochloride |
| PubChem CID | 126807686 |
| Molecular Formula | C5H10Cl2N2S |
| Molecular Weight | 201.12 g/mol |
| Exact Mass | 199.99 |
| IUPAC Name | 1-(1,2-thiazol-5-yl)ethanamine;dihydrochloride |
| SMILES | CC(N)c1ccns1.Cl.Cl |
| InChI | InChI=1S/C5H8N2S.2ClH/c1-4(6)5-2-3-7-8-5;;/h2-4H,6H2,1H3;2*1H |
| InChIKey | CTDMZTCEAVXWCT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.12 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1,2-thiazol-5-yl)ethanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2-thiazol-5-yl)ethanamine;dihydrochloride?
The IUPAC name of 1-(1,2-thiazol-5-yl)ethanamine;dihydrochloride (CID 126807686) is 1-(1,2-thiazol-5-yl)ethanamine;dihydrochloride.
What is the SMILES notation for 1-(1,2-thiazol-5-yl)ethanamine;dihydrochloride?
The canonical SMILES for 1-(1,2-thiazol-5-yl)ethanamine;dihydrochloride is CC(N)c1ccns1.Cl.Cl.
What is the InChIKey of 1-(1,2-thiazol-5-yl)ethanamine;dihydrochloride?
The InChIKey is CTDMZTCEAVXWCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2S.2ClH/c1-4(6)5-2-3-7-8-5;;/h2-4H,6H2,1H3;2*1H.
What are the key properties of 1-(1,2-thiazol-5-yl)ethanamine;dihydrochloride?
1-(1,2-thiazol-5-yl)ethanamine;dihydrochloride has a molecular weight of 201.12 g/mol, XLogP of 2.01, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2-thiazol-5-yl)ethanamine;dihydrochloride is sourced from PubChem (CID 126807686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).