C16H19F3N2O2 — CID 126808146
2-(6-oxopiperidin-2-yl)-N-phenyl-N-(3,3,3-trifluoropropyl)acetamide (PubChem CID 126808146) has the molecular formula C16H19F3N2O2 and a molecular weight of 328.33 g/mol. Its IUPAC name is 2-(6-oxopiperidin-2-yl)-N-phenyl-N-(3,3,3-trifluoropropyl)acetamide.
| Compound Name | 2-(6-oxopiperidin-2-yl)-N-phenyl-N-(3,3,3-trifluoropropyl)acetamide |
|---|---|
| PubChem CID | 126808146 |
| Molecular Formula | C16H19F3N2O2 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 2-(6-oxopiperidin-2-yl)-N-phenyl-N-(3,3,3-trifluoropropyl)acetamide |
| SMILES | O=C1CCCC(CC(=O)N(CCC(F)(F)F)c2ccccc2)N1 |
| InChI | InChI=1S/C16H19F3N2O2/c17-16(18,19)9-10-21(13-6-2-1-3-7-13)15(23)11-12-5-4-8-14(22)20-12/h1-3,6-7,12H,4-5,8-11H2,(H,20,22) |
| InChIKey | QVRIBDOBINFWSH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |