About (2S)-2-phenyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid
(2S)-2-phenyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid (PubChem CID 1268083) has the molecular formula C10H8F3NO3
and a molecular weight of 247.17 g/mol. Its IUPAC name is (2S)-2-phenyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid.
Molecular Properties
| Compound Name | (2S)-2-phenyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid |
| PubChem CID | 1268083 |
| Molecular Formula | C10H8F3NO3 |
| Molecular Weight | 247.17 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | (2S)-2-phenyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid |
| SMILES | O=C(O)[C@@H](NC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C10H8F3NO3/c11-10(12,13)9(17)14-7(8(15)16)6-4-2-1-3-5-6/h1-5,7H,(H,14,17)(H,15,16)/t7-/m0/s1 |
| InChIKey | AFPBGEGBLXHXNY-ZETCQYMHSA-N |
| XLogP | 1.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.17 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-phenyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-phenyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid?
The IUPAC name of (2S)-2-phenyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid (CID 1268083) is (2S)-2-phenyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid.
What is the SMILES notation for (2S)-2-phenyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid?
The canonical SMILES for (2S)-2-phenyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid is O=C(O)[C@@H](NC(=O)C(F)(F)F)c1ccccc1.
What is the InChIKey of (2S)-2-phenyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid?
The InChIKey is AFPBGEGBLXHXNY-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H8F3NO3/c11-10(12,13)9(17)14-7(8(15)16)6-4-2-1-3-5-6/h1-5,7H,(H,14,17)(H,15,16)/t7-/m0/s1.
What are the key properties of (2S)-2-phenyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid?
(2S)-2-phenyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid has a molecular weight of 247.17 g/mol, XLogP of 1.49, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-phenyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid is sourced from PubChem (CID 1268083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).