C8H16Cl2N4 — CID 126809354
1-(5-methyl-1H-pyrazol-3-yl)piperazine;dihydrochloride (PubChem CID 126809354) has the molecular formula C8H16Cl2N4 and a molecular weight of 239.15 g/mol. Its IUPAC name is 1-(5-methyl-1H-pyrazol-3-yl)piperazine;dihydrochloride.
| Compound Name | 1-(5-methyl-1H-pyrazol-3-yl)piperazine;dihydrochloride |
|---|---|
| PubChem CID | 126809354 |
| Molecular Formula | C8H16Cl2N4 |
| Molecular Weight | 239.15 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 1-(5-methyl-1H-pyrazol-3-yl)piperazine;dihydrochloride |
| SMILES | Cc1cc(N2CCNCC2)n[nH]1.Cl.Cl |
| InChI | InChI=1S/C8H14N4.2ClH/c1-7-6-8(11-10-7)12-4-2-9-3-5-12;;/h6,9H,2-5H2,1H3,(H,10,11);2*1H |
| InChIKey | ZRIGWTOOAAJUHX-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.15 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |