About 3-amino-N,N-dimethylazetidine-1-sulfonamide;hydrochloride
3-amino-N,N-dimethylazetidine-1-sulfonamide;hydrochloride (PubChem CID 126809377) has the molecular formula C5H14ClN3O2S
and a molecular weight of 215.71 g/mol. Its IUPAC name is 3-amino-N,N-dimethylazetidine-1-sulfonamide;hydrochloride.
Molecular Properties
| Compound Name | 3-amino-N,N-dimethylazetidine-1-sulfonamide;hydrochloride |
| PubChem CID | 126809377 |
| Molecular Formula | C5H14ClN3O2S |
| Molecular Weight | 215.71 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 3-amino-N,N-dimethylazetidine-1-sulfonamide;hydrochloride |
| SMILES | CN(C)S(=O)(=O)N1CC(N)C1.Cl |
| InChI | InChI=1S/C5H13N3O2S.ClH/c1-7(2)11(9,10)8-3-5(6)4-8;/h5H,3-4,6H2,1-2H3;1H |
| InChIKey | XLJDLLFFMFVAJM-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.71 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-N,N-dimethylazetidine-1-sulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N,N-dimethylazetidine-1-sulfonamide;hydrochloride?
The IUPAC name of 3-amino-N,N-dimethylazetidine-1-sulfonamide;hydrochloride (CID 126809377) is 3-amino-N,N-dimethylazetidine-1-sulfonamide;hydrochloride.
What is the SMILES notation for 3-amino-N,N-dimethylazetidine-1-sulfonamide;hydrochloride?
The canonical SMILES for 3-amino-N,N-dimethylazetidine-1-sulfonamide;hydrochloride is CN(C)S(=O)(=O)N1CC(N)C1.Cl.
What is the InChIKey of 3-amino-N,N-dimethylazetidine-1-sulfonamide;hydrochloride?
The InChIKey is XLJDLLFFMFVAJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3O2S.ClH/c1-7(2)11(9,10)8-3-5(6)4-8;/h5H,3-4,6H2,1-2H3;1H.
What are the key properties of 3-amino-N,N-dimethylazetidine-1-sulfonamide;hydrochloride?
3-amino-N,N-dimethylazetidine-1-sulfonamide;hydrochloride has a molecular weight of 215.71 g/mol, XLogP of -1.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N,N-dimethylazetidine-1-sulfonamide;hydrochloride is sourced from PubChem (CID 126809377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).