About 2-amino-1-pyridin-2-ylpropane-1,3-diol;dihydrochloride
2-amino-1-pyridin-2-ylpropane-1,3-diol;dihydrochloride (PubChem CID 126809383) has the molecular formula C8H14Cl2N2O2
and a molecular weight of 241.12 g/mol. Its IUPAC name is 2-amino-1-pyridin-2-ylpropane-1,3-diol;dihydrochloride.
Molecular Properties
| Compound Name | 2-amino-1-pyridin-2-ylpropane-1,3-diol;dihydrochloride |
| PubChem CID | 126809383 |
| Molecular Formula | C8H14Cl2N2O2 |
| Molecular Weight | 241.12 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 2-amino-1-pyridin-2-ylpropane-1,3-diol;dihydrochloride |
| SMILES | Cl.Cl.NC(CO)C(O)c1ccccn1 |
| InChI | InChI=1S/C8H12N2O2.2ClH/c9-6(5-11)8(12)7-3-1-2-4-10-7;;/h1-4,6,8,11-12H,5,9H2;2*1H |
| InChIKey | KBSSOFQXYWUDFM-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.12 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-1-pyridin-2-ylpropane-1,3-diol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-pyridin-2-ylpropane-1,3-diol;dihydrochloride?
The IUPAC name of 2-amino-1-pyridin-2-ylpropane-1,3-diol;dihydrochloride (CID 126809383) is 2-amino-1-pyridin-2-ylpropane-1,3-diol;dihydrochloride.
What is the SMILES notation for 2-amino-1-pyridin-2-ylpropane-1,3-diol;dihydrochloride?
The canonical SMILES for 2-amino-1-pyridin-2-ylpropane-1,3-diol;dihydrochloride is Cl.Cl.NC(CO)C(O)c1ccccn1.
What is the InChIKey of 2-amino-1-pyridin-2-ylpropane-1,3-diol;dihydrochloride?
The InChIKey is KBSSOFQXYWUDFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2.2ClH/c9-6(5-11)8(12)7-3-1-2-4-10-7;;/h1-4,6,8,11-12H,5,9H2;2*1H.
What are the key properties of 2-amino-1-pyridin-2-ylpropane-1,3-diol;dihydrochloride?
2-amino-1-pyridin-2-ylpropane-1,3-diol;dihydrochloride has a molecular weight of 241.12 g/mol, XLogP of 0.28, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-pyridin-2-ylpropane-1,3-diol;dihydrochloride is sourced from PubChem (CID 126809383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).