About 4-methyl-3-thiophen-3-ylaniline;hydrochloride
4-methyl-3-thiophen-3-ylaniline;hydrochloride (PubChem CID 126809403) has the molecular formula C11H12ClNS
and a molecular weight of 225.74 g/mol. Its IUPAC name is 4-methyl-3-thiophen-3-ylaniline;hydrochloride.
Molecular Properties
| Compound Name | 4-methyl-3-thiophen-3-ylaniline;hydrochloride |
| PubChem CID | 126809403 |
| Molecular Formula | C11H12ClNS |
| Molecular Weight | 225.74 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 4-methyl-3-thiophen-3-ylaniline;hydrochloride |
| SMILES | Cc1ccc(N)cc1-c1ccsc1.Cl |
| InChI | InChI=1S/C11H11NS.ClH/c1-8-2-3-10(12)6-11(8)9-4-5-13-7-9;/h2-7H,12H2,1H3;1H |
| InChIKey | RBBDZSUMZAAHMN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.74 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3-thiophen-3-ylaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-thiophen-3-ylaniline;hydrochloride?
The IUPAC name of 4-methyl-3-thiophen-3-ylaniline;hydrochloride (CID 126809403) is 4-methyl-3-thiophen-3-ylaniline;hydrochloride.
What is the SMILES notation for 4-methyl-3-thiophen-3-ylaniline;hydrochloride?
The canonical SMILES for 4-methyl-3-thiophen-3-ylaniline;hydrochloride is Cc1ccc(N)cc1-c1ccsc1.Cl.
What is the InChIKey of 4-methyl-3-thiophen-3-ylaniline;hydrochloride?
The InChIKey is RBBDZSUMZAAHMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NS.ClH/c1-8-2-3-10(12)6-11(8)9-4-5-13-7-9;/h2-7H,12H2,1H3;1H.
What are the key properties of 4-methyl-3-thiophen-3-ylaniline;hydrochloride?
4-methyl-3-thiophen-3-ylaniline;hydrochloride has a molecular weight of 225.74 g/mol, XLogP of 3.73, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-thiophen-3-ylaniline;hydrochloride is sourced from PubChem (CID 126809403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).