About potassium 5-oxo-7,8-dihydro-6H-quinazoline-2-thiolate
potassium 5-oxo-7,8-dihydro-6H-quinazoline-2-thiolate (PubChem CID 126809413) has the molecular formula C8H7KN2OS
and a molecular weight of 218.32 g/mol. Its IUPAC name is potassium 5-oxo-7,8-dihydro-6H-quinazoline-2-thiolate.
Molecular Properties
| Compound Name | potassium 5-oxo-7,8-dihydro-6H-quinazoline-2-thiolate |
| PubChem CID | 126809413 |
| Molecular Formula | C8H7KN2OS |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | potassium 5-oxo-7,8-dihydro-6H-quinazoline-2-thiolate |
| SMILES | O=C1CCCc2nc([S-])ncc21.[K+] |
| InChI | InChI=1S/C8H8N2OS.K/c11-7-3-1-2-6-5(7)4-9-8(12)10-6;/h4H,1-3H2,(H,9,10,12);/q;+1/p-1 |
| InChIKey | VYHZKQQJWMQUNM-UHFFFAOYSA-M |
| XLogP | -2.09 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze potassium 5-oxo-7,8-dihydro-6H-quinazoline-2-thiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 5-oxo-7,8-dihydro-6H-quinazoline-2-thiolate?
The IUPAC name of potassium 5-oxo-7,8-dihydro-6H-quinazoline-2-thiolate (CID 126809413) is potassium 5-oxo-7,8-dihydro-6H-quinazoline-2-thiolate.
What is the SMILES notation for potassium 5-oxo-7,8-dihydro-6H-quinazoline-2-thiolate?
The canonical SMILES for potassium 5-oxo-7,8-dihydro-6H-quinazoline-2-thiolate is O=C1CCCc2nc([S-])ncc21.[K+].
What is the InChIKey of potassium 5-oxo-7,8-dihydro-6H-quinazoline-2-thiolate?
The InChIKey is VYHZKQQJWMQUNM-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H8N2OS.K/c11-7-3-1-2-6-5(7)4-9-8(12)10-6;/h4H,1-3H2,(H,9,10,12);/q;+1/p-1.
What are the key properties of potassium 5-oxo-7,8-dihydro-6H-quinazoline-2-thiolate?
potassium 5-oxo-7,8-dihydro-6H-quinazoline-2-thiolate has a molecular weight of 218.32 g/mol, XLogP of -2.09, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 5-oxo-7,8-dihydro-6H-quinazoline-2-thiolate is sourced from PubChem (CID 126809413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).