C12H16N4O3 — CID 126809634
4-(4-imidazol-1-ylpiperidine-1-carbonyl)-1,3-oxazolidin-2-one (PubChem CID 126809634) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 4-(4-imidazol-1-ylpiperidine-1-carbonyl)-1,3-oxazolidin-2-one.
| Compound Name | 4-(4-imidazol-1-ylpiperidine-1-carbonyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 126809634 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 4-(4-imidazol-1-ylpiperidine-1-carbonyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(C(=O)N2CCC(n3ccnc3)CC2)CO1 |
| InChI | InChI=1S/C12H16N4O3/c17-11(10-7-19-12(18)14-10)15-4-1-9(2-5-15)16-6-3-13-8-16/h3,6,8-10H,1-2,4-5,7H2,(H,14,18) |
| InChIKey | SUTXKEIXVIYKIJ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |