C10H9F3N2O2 — CID 126809836
6-[3-(trifluoromethyl)azetidine-1-carbonyl]-1H-pyridin-2-one (PubChem CID 126809836) has the molecular formula C10H9F3N2O2 and a molecular weight of 246.19 g/mol. Its IUPAC name is 6-[3-(trifluoromethyl)azetidine-1-carbonyl]-1H-pyridin-2-one.
| Compound Name | 6-[3-(trifluoromethyl)azetidine-1-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 126809836 |
| Molecular Formula | C10H9F3N2O2 |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 6-[3-(trifluoromethyl)azetidine-1-carbonyl]-1H-pyridin-2-one |
| SMILES | O=C(c1cccc(=O)[nH]1)N1CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C10H9F3N2O2/c11-10(12,13)6-4-15(5-6)9(17)7-2-1-3-8(16)14-7/h1-3,6H,4-5H2,(H,14,16) |
| InChIKey | CREKNKYSGUFDNI-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |