C5HF6NO2 — CID 12681002
3,3,4,4,5,5-hexafluoropiperidine-2,6-dione (PubChem CID 12681002) has the molecular formula C5HF6NO2 and a molecular weight of 221.06 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoropiperidine-2,6-dione.
| Compound Name | 3,3,4,4,5,5-hexafluoropiperidine-2,6-dione |
|---|---|
| PubChem CID | 12681002 |
| Molecular Formula | C5HF6NO2 |
| Molecular Weight | 221.06 g/mol |
| Exact Mass | 220.99 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoropiperidine-2,6-dione |
| SMILES | O=C1NC(=O)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C5HF6NO2/c6-3(7)1(13)12-2(14)4(8,9)5(3,10)11/h(H,12,13,14) |
| InChIKey | NQPCJIWEFNUPGL-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.06 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|