About N-(2-ethoxyethyl)-2,3-dihydro-1H-inden-1-amine;hydrochloride
N-(2-ethoxyethyl)-2,3-dihydro-1H-inden-1-amine;hydrochloride (PubChem CID 126810075) has the molecular formula C13H20ClNO
and a molecular weight of 241.76 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-2,3-dihydro-1H-inden-1-amine;hydrochloride.
Molecular Properties
| Compound Name | N-(2-ethoxyethyl)-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| PubChem CID | 126810075 |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 241.76 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | N-(2-ethoxyethyl)-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| SMILES | CCOCCNC1CCc2ccccc21.Cl |
| InChI | InChI=1S/C13H19NO.ClH/c1-2-15-10-9-14-13-8-7-11-5-3-4-6-12(11)13;/h3-6,13-14H,2,7-10H2,1H3;1H |
| InChIKey | FEHFAVHBLUVYOQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.76 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-ethoxyethyl)-2,3-dihydro-1H-inden-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethoxyethyl)-2,3-dihydro-1H-inden-1-amine;hydrochloride?
The IUPAC name of N-(2-ethoxyethyl)-2,3-dihydro-1H-inden-1-amine;hydrochloride (CID 126810075) is N-(2-ethoxyethyl)-2,3-dihydro-1H-inden-1-amine;hydrochloride.
What is the SMILES notation for N-(2-ethoxyethyl)-2,3-dihydro-1H-inden-1-amine;hydrochloride?
The canonical SMILES for N-(2-ethoxyethyl)-2,3-dihydro-1H-inden-1-amine;hydrochloride is CCOCCNC1CCc2ccccc21.Cl.
What is the InChIKey of N-(2-ethoxyethyl)-2,3-dihydro-1H-inden-1-amine;hydrochloride?
The InChIKey is FEHFAVHBLUVYOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO.ClH/c1-2-15-10-9-14-13-8-7-11-5-3-4-6-12(11)13;/h3-6,13-14H,2,7-10H2,1H3;1H.
What are the key properties of N-(2-ethoxyethyl)-2,3-dihydro-1H-inden-1-amine;hydrochloride?
N-(2-ethoxyethyl)-2,3-dihydro-1H-inden-1-amine;hydrochloride has a molecular weight of 241.76 g/mol, XLogP of 2.72, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethoxyethyl)-2,3-dihydro-1H-inden-1-amine;hydrochloride is sourced from PubChem (CID 126810075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).