C18H21N3O3 — CID 126810227
3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-(3-phenylmethoxypropyl)-1,2,4-oxadiazole (PubChem CID 126810227) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-(3-phenylmethoxypropyl)-1,2,4-oxadiazole.
| Compound Name | 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-(3-phenylmethoxypropyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 126810227 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-(3-phenylmethoxypropyl)-1,2,4-oxadiazole |
| SMILES | Cc1noc(C)c1Cc1noc(CCCOCc2ccccc2)n1 |
| InChI | InChI=1S/C18H21N3O3/c1-13-16(14(2)23-20-13)11-17-19-18(24-21-17)9-6-10-22-12-15-7-4-3-5-8-15/h3-5,7-8H,6,9-12H2,1-2H3 |
| InChIKey | STZXFPHHDDMIRA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 74.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|