C17H19ClN6O — CID 126810236
1-tert-butyl-N-[1-(3-chlorophenyl)-5-methylpyrazol-3-yl]triazole-4-carboxamide (PubChem CID 126810236) has the molecular formula C17H19ClN6O and a molecular weight of 358.83 g/mol. Its IUPAC name is 1-tert-butyl-N-[1-(3-chlorophenyl)-5-methylpyrazol-3-yl]triazole-4-carboxamide.
| Compound Name | 1-tert-butyl-N-[1-(3-chlorophenyl)-5-methylpyrazol-3-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 126810236 |
| Molecular Formula | C17H19ClN6O |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1-tert-butyl-N-[1-(3-chlorophenyl)-5-methylpyrazol-3-yl]triazole-4-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cn(C(C)(C)C)nn2)nn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H19ClN6O/c1-11-8-15(21-24(11)13-7-5-6-12(18)9-13)19-16(25)14-10-23(22-20-14)17(2,3)4/h5-10H,1-4H3,(H,19,21,25) |
| InChIKey | RZCGHXHBTCIBAO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |