About 6-sulfanylidene-3,7-dihydropurin-2-one
6-sulfanylidene-3,7-dihydropurin-2-one (PubChem CID 1268107) has the molecular formula C5H4N4OS
and a molecular weight of 168.18 g/mol. Its IUPAC name is 6-sulfanylidene-3,7-dihydropurin-2-one.
Molecular Properties
| Compound Name | 6-sulfanylidene-3,7-dihydropurin-2-one |
| PubChem CID | 1268107 |
| Molecular Formula | C5H4N4OS |
| Molecular Weight | 168.18 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 6-sulfanylidene-3,7-dihydropurin-2-one |
| SMILES | O=c1[nH]c(=S)c2[nH]cnc2[nH]1 |
| InChI | InChI=1S/C5H4N4OS/c10-5-8-3-2(4(11)9-5)6-1-7-3/h1H,(H3,6,7,8,9,10,11) |
| InChIKey | RJOXFJDOUQJOMQ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.18 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-sulfanylidene-3,7-dihydropurin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-sulfanylidene-3,7-dihydropurin-2-one?
The IUPAC name of 6-sulfanylidene-3,7-dihydropurin-2-one (CID 1268107) is 6-sulfanylidene-3,7-dihydropurin-2-one.
What is the SMILES notation for 6-sulfanylidene-3,7-dihydropurin-2-one?
The canonical SMILES for 6-sulfanylidene-3,7-dihydropurin-2-one is O=c1[nH]c(=S)c2[nH]cnc2[nH]1.
What is the InChIKey of 6-sulfanylidene-3,7-dihydropurin-2-one?
The InChIKey is RJOXFJDOUQJOMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4OS/c10-5-8-3-2(4(11)9-5)6-1-7-3/h1H,(H3,6,7,8,9,10,11).
What are the key properties of 6-sulfanylidene-3,7-dihydropurin-2-one?
6-sulfanylidene-3,7-dihydropurin-2-one has a molecular weight of 168.18 g/mol, XLogP of 0.31, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-sulfanylidene-3,7-dihydropurin-2-one is sourced from PubChem (CID 1268107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).