About 2,2-dipropylpyrrolidine;hydrochloride
2,2-dipropylpyrrolidine;hydrochloride (PubChem CID 126810792) has the molecular formula C10H22ClN
and a molecular weight of 191.75 g/mol. Its IUPAC name is 2,2-dipropylpyrrolidine;hydrochloride.
Molecular Properties
| Compound Name | 2,2-dipropylpyrrolidine;hydrochloride |
| PubChem CID | 126810792 |
| Molecular Formula | C10H22ClN |
| Molecular Weight | 191.75 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 2,2-dipropylpyrrolidine;hydrochloride |
| SMILES | CCCC1(CCC)CCCN1.Cl |
| InChI | InChI=1S/C10H21N.ClH/c1-3-6-10(7-4-2)8-5-9-11-10;/h11H,3-9H2,1-2H3;1H |
| InChIKey | MUWDHLSLLBGWHG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.75 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-dipropylpyrrolidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dipropylpyrrolidine;hydrochloride?
The IUPAC name of 2,2-dipropylpyrrolidine;hydrochloride (CID 126810792) is 2,2-dipropylpyrrolidine;hydrochloride.
What is the SMILES notation for 2,2-dipropylpyrrolidine;hydrochloride?
The canonical SMILES for 2,2-dipropylpyrrolidine;hydrochloride is CCCC1(CCC)CCCN1.Cl.
What is the InChIKey of 2,2-dipropylpyrrolidine;hydrochloride?
The InChIKey is MUWDHLSLLBGWHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N.ClH/c1-3-6-10(7-4-2)8-5-9-11-10;/h11H,3-9H2,1-2H3;1H.
What are the key properties of 2,2-dipropylpyrrolidine;hydrochloride?
2,2-dipropylpyrrolidine;hydrochloride has a molecular weight of 191.75 g/mol, XLogP of 3.13, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dipropylpyrrolidine;hydrochloride is sourced from PubChem (CID 126810792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).