About N-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]-N-methylpyridine-3-sulfonamide
N-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]-N-methylpyridine-3-sulfonamide (PubChem CID 126810877) has the molecular formula C14H23N3O3S
and a molecular weight of 313.42 g/mol. Its IUPAC name is N-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]-N-methylpyridine-3-sulfonamide.
Molecular Properties
| Compound Name | N-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]-N-methylpyridine-3-sulfonamide |
| PubChem CID | 126810877 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | N-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]-N-methylpyridine-3-sulfonamide |
| SMILES | C[C@@H]1CN(CCN(C)S(=O)(=O)c2cccnc2)C[C@H](C)O1 |
| InChI | InChI=1S/C14H23N3O3S/c1-12-10-17(11-13(2)20-12)8-7-16(3)21(18,19)14-5-4-6-15-9-14/h4-6,9,12-13H,7-8,10-11H2,1-3H3/t12-,13+ |
| InChIKey | RDSZKPHGRQYGSJ-BETUJISGSA-N |
| XLogP | 0.81 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]-N-methylpyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]-N-methylpyridine-3-sulfonamide?
The IUPAC name of N-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]-N-methylpyridine-3-sulfonamide (CID 126810877) is N-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]-N-methylpyridine-3-sulfonamide.
What is the SMILES notation for N-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]-N-methylpyridine-3-sulfonamide?
The canonical SMILES for N-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]-N-methylpyridine-3-sulfonamide is C[C@@H]1CN(CCN(C)S(=O)(=O)c2cccnc2)C[C@H](C)O1.
What is the InChIKey of N-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]-N-methylpyridine-3-sulfonamide?
The InChIKey is RDSZKPHGRQYGSJ-BETUJISGSA-N. The full InChI is InChI=1S/C14H23N3O3S/c1-12-10-17(11-13(2)20-12)8-7-16(3)21(18,19)14-5-4-6-15-9-14/h4-6,9,12-13H,7-8,10-11H2,1-3H3/t12-,13+.
What are the key properties of N-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]-N-methylpyridine-3-sulfonamide?
N-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]-N-methylpyridine-3-sulfonamide has a molecular weight of 313.42 g/mol, XLogP of 0.81, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]-N-methylpyridine-3-sulfonamide is sourced from PubChem (CID 126810877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).