C8H14Cl2N2S — CID 126810939
5-piperidin-4-yl-1,3-thiazole;dihydrochloride (PubChem CID 126810939) has the molecular formula C8H14Cl2N2S and a molecular weight of 241.19 g/mol. Its IUPAC name is 5-piperidin-4-yl-1,3-thiazole;dihydrochloride.
| Compound Name | 5-piperidin-4-yl-1,3-thiazole;dihydrochloride |
|---|---|
| PubChem CID | 126810939 |
| Molecular Formula | C8H14Cl2N2S |
| Molecular Weight | 241.19 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 5-piperidin-4-yl-1,3-thiazole;dihydrochloride |
| SMILES | Cl.Cl.c1ncc(C2CCNCC2)s1 |
| InChI | InChI=1S/C8H12N2S.2ClH/c1-3-9-4-2-7(1)8-5-10-6-11-8;;/h5-7,9H,1-4H2;2*1H |
| InChIKey | NQAYOJMUMZDXHB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |