C9H9F4N3O2 — CID 126810954
2,2,3,3-tetrafluoropropyl 4-amino-2-methylpyrimidine-5-carboxylate (PubChem CID 126810954) has the molecular formula C9H9F4N3O2 and a molecular weight of 267.18 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl 4-amino-2-methylpyrimidine-5-carboxylate.
| Compound Name | 2,2,3,3-tetrafluoropropyl 4-amino-2-methylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 126810954 |
| Molecular Formula | C9H9F4N3O2 |
| Molecular Weight | 267.18 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl 4-amino-2-methylpyrimidine-5-carboxylate |
| SMILES | Cc1ncc(C(=O)OCC(F)(F)C(F)F)c(N)n1 |
| InChI | InChI=1S/C9H9F4N3O2/c1-4-15-2-5(6(14)16-4)7(17)18-3-9(12,13)8(10)11/h2,8H,3H2,1H3,(H2,14,15,16) |
| InChIKey | XTFFRLHOFNQCTF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|