C12H18Cl2N4O — CID 126810966
5-[4-[(2,2-dichlorocyclopropyl)methyl]-1-methylpiperazin-2-yl]-3-methyl-1,2,4-oxadiazole (PubChem CID 126810966) has the molecular formula C12H18Cl2N4O and a molecular weight of 305.21 g/mol. Its IUPAC name is 5-[4-[(2,2-dichlorocyclopropyl)methyl]-1-methylpiperazin-2-yl]-3-methyl-1,2,4-oxadiazole.
| Compound Name | 5-[4-[(2,2-dichlorocyclopropyl)methyl]-1-methylpiperazin-2-yl]-3-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 126810966 |
| Molecular Formula | C12H18Cl2N4O |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 5-[4-[(2,2-dichlorocyclopropyl)methyl]-1-methylpiperazin-2-yl]-3-methyl-1,2,4-oxadiazole |
| SMILES | Cc1noc(C2CN(CC3CC3(Cl)Cl)CCN2C)n1 |
| InChI | InChI=1S/C12H18Cl2N4O/c1-8-15-11(19-16-8)10-7-18(4-3-17(10)2)6-9-5-12(9,13)14/h9-10H,3-7H2,1-2H3 |
| InChIKey | NSKVGRUHYDYLMM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|