C14H22N6 — CID 126810988
N,N'-dimethyl-N,N'-bis(1-methylpyrazol-3-yl)but-2-ene-1,4-diamine (PubChem CID 126810988) has the molecular formula C14H22N6 and a molecular weight of 274.37 g/mol. Its IUPAC name is N,N'-dimethyl-N,N'-bis(1-methylpyrazol-3-yl)but-2-ene-1,4-diamine.
| Compound Name | N,N'-dimethyl-N,N'-bis(1-methylpyrazol-3-yl)but-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 126810988 |
| Molecular Formula | C14H22N6 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | N,N'-dimethyl-N,N'-bis(1-methylpyrazol-3-yl)but-2-ene-1,4-diamine |
| SMILES | CN(CC=CCN(C)c1ccn(C)n1)c1ccn(C)n1 |
| InChI | InChI=1S/C14H22N6/c1-17(13-7-11-19(3)15-13)9-5-6-10-18(2)14-8-12-20(4)16-14/h5-8,11-12H,9-10H2,1-4H3 |
| InChIKey | XWSOPRJIEUGCLZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 42.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|