C19H29F2N5O — CID 126811242
[1-(2,2-difluoroethyl)piperidin-4-yl]-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)pyrrolidin-1-yl]methanone (PubChem CID 126811242) has the molecular formula C19H29F2N5O and a molecular weight of 381.47 g/mol. Its IUPAC name is [1-(2,2-difluoroethyl)piperidin-4-yl]-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)pyrrolidin-1-yl]methanone.
| Compound Name | [1-(2,2-difluoroethyl)piperidin-4-yl]-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 126811242 |
| Molecular Formula | C19H29F2N5O |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | [1-(2,2-difluoroethyl)piperidin-4-yl]-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(C1CCN(CC(F)F)CC1)N1CCCC1c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C19H29F2N5O/c20-16(21)13-24-11-7-14(8-12-24)19(27)25-10-4-5-15(25)18-23-22-17-6-2-1-3-9-26(17)18/h14-16H,1-13H2 |
| InChIKey | UCXINXQJKBDMCK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |