C9H10O8 — CID 1268114
(1S,2R,3R,4R)-cyclopentane-1,2,3,4-tetracarboxylic acid (PubChem CID 1268114) has the molecular formula C9H10O8 and a molecular weight of 246.17 g/mol. Its IUPAC name is (1S,2R,3R,4R)-cyclopentane-1,2,3,4-tetracarboxylic acid.
| Compound Name | (1S,2R,3R,4R)-cyclopentane-1,2,3,4-tetracarboxylic acid |
|---|---|
| PubChem CID | 1268114 |
| Molecular Formula | C9H10O8 |
| Molecular Weight | 246.17 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | (1S,2R,3R,4R)-cyclopentane-1,2,3,4-tetracarboxylic acid |
| SMILES | O=C(O)[C@H]1[C@H](C(=O)O)[C@H](C(=O)O)C[C@@H]1C(=O)O |
| InChI | InChI=1S/C9H10O8/c10-6(11)2-1-3(7(12)13)5(9(16)17)4(2)8(14)15/h2-5H,1H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17)/t2-,3+,4-,5-/m1/s1 |
| InChIKey | WOSVXXBNNCUXMT-KKQCNMDGSA-N |
| XLogP | -0.81 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.17 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |