About 5-[4-(5-fluoro-2,3-dihydroindol-1-yl)piperidin-1-yl]sulfonyl-2-methyl-1,3-thiazole
5-[4-(5-fluoro-2,3-dihydroindol-1-yl)piperidin-1-yl]sulfonyl-2-methyl-1,3-thiazole (PubChem CID 126811409) has the molecular formula C17H20FN3O2S2
and a molecular weight of 381.50 g/mol. Its IUPAC name is 5-[4-(5-fluoro-2,3-dihydroindol-1-yl)piperidin-1-yl]sulfonyl-2-methyl-1,3-thiazole.
Molecular Properties
| Compound Name | 5-[4-(5-fluoro-2,3-dihydroindol-1-yl)piperidin-1-yl]sulfonyl-2-methyl-1,3-thiazole |
| PubChem CID | 126811409 |
| Molecular Formula | C17H20FN3O2S2 |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 5-[4-(5-fluoro-2,3-dihydroindol-1-yl)piperidin-1-yl]sulfonyl-2-methyl-1,3-thiazole |
| SMILES | Cc1ncc(S(=O)(=O)N2CCC(N3CCc4cc(F)ccc43)CC2)s1 |
| InChI | InChI=1S/C17H20FN3O2S2/c1-12-19-11-17(24-12)25(22,23)20-7-5-15(6-8-20)21-9-4-13-10-14(18)2-3-16(13)21/h2-3,10-11,15H,4-9H2,1H3 |
| InChIKey | MGNNNEAPUCAJNV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[4-(5-fluoro-2,3-dihydroindol-1-yl)piperidin-1-yl]sulfonyl-2-methyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(5-fluoro-2,3-dihydroindol-1-yl)piperidin-1-yl]sulfonyl-2-methyl-1,3-thiazole?
The IUPAC name of 5-[4-(5-fluoro-2,3-dihydroindol-1-yl)piperidin-1-yl]sulfonyl-2-methyl-1,3-thiazole (CID 126811409) is 5-[4-(5-fluoro-2,3-dihydroindol-1-yl)piperidin-1-yl]sulfonyl-2-methyl-1,3-thiazole.
What is the SMILES notation for 5-[4-(5-fluoro-2,3-dihydroindol-1-yl)piperidin-1-yl]sulfonyl-2-methyl-1,3-thiazole?
The canonical SMILES for 5-[4-(5-fluoro-2,3-dihydroindol-1-yl)piperidin-1-yl]sulfonyl-2-methyl-1,3-thiazole is Cc1ncc(S(=O)(=O)N2CCC(N3CCc4cc(F)ccc43)CC2)s1.
What is the InChIKey of 5-[4-(5-fluoro-2,3-dihydroindol-1-yl)piperidin-1-yl]sulfonyl-2-methyl-1,3-thiazole?
The InChIKey is MGNNNEAPUCAJNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20FN3O2S2/c1-12-19-11-17(24-12)25(22,23)20-7-5-15(6-8-20)21-9-4-13-10-14(18)2-3-16(13)21/h2-3,10-11,15H,4-9H2,1H3.
What are the key properties of 5-[4-(5-fluoro-2,3-dihydroindol-1-yl)piperidin-1-yl]sulfonyl-2-methyl-1,3-thiazole?
5-[4-(5-fluoro-2,3-dihydroindol-1-yl)piperidin-1-yl]sulfonyl-2-methyl-1,3-thiazole has a molecular weight of 381.50 g/mol, XLogP of 2.81, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(5-fluoro-2,3-dihydroindol-1-yl)piperidin-1-yl]sulfonyl-2-methyl-1,3-thiazole is sourced from PubChem (CID 126811409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).