About ethyl 7-oxocyclohepta-1,3,5-triene-1-carboxylate
ethyl 7-oxocyclohepta-1,3,5-triene-1-carboxylate (PubChem CID 12681178) has the molecular formula C10H10O3
and a molecular weight of 178.19 g/mol. Its IUPAC name is ethyl 7-oxocyclohepta-1,3,5-triene-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-oxocyclohepta-1,3,5-triene-1-carboxylate |
| PubChem CID | 12681178 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | ethyl 7-oxocyclohepta-1,3,5-triene-1-carboxylate |
| SMILES | CCOC(=O)c1cccccc1=O |
| InChI | InChI=1S/C10H10O3/c1-2-13-10(12)8-6-4-3-5-7-9(8)11/h3-7H,2H2,1H3 |
| InChIKey | QKZWVPUCPWPZIY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 7-oxocyclohepta-1,3,5-triene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-oxocyclohepta-1,3,5-triene-1-carboxylate?
The IUPAC name of ethyl 7-oxocyclohepta-1,3,5-triene-1-carboxylate (CID 12681178) is ethyl 7-oxocyclohepta-1,3,5-triene-1-carboxylate.
What is the SMILES notation for ethyl 7-oxocyclohepta-1,3,5-triene-1-carboxylate?
The canonical SMILES for ethyl 7-oxocyclohepta-1,3,5-triene-1-carboxylate is CCOC(=O)c1cccccc1=O.
What is the InChIKey of ethyl 7-oxocyclohepta-1,3,5-triene-1-carboxylate?
The InChIKey is QKZWVPUCPWPZIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3/c1-2-13-10(12)8-6-4-3-5-7-9(8)11/h3-7H,2H2,1H3.
What are the key properties of ethyl 7-oxocyclohepta-1,3,5-triene-1-carboxylate?
ethyl 7-oxocyclohepta-1,3,5-triene-1-carboxylate has a molecular weight of 178.19 g/mol, XLogP of 1.22, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-oxocyclohepta-1,3,5-triene-1-carboxylate is sourced from PubChem (CID 12681178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).