C18H19N5O2S — CID 126812082
2-(benzimidazol-1-yl)-N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethoxy]ethanimidamide (PubChem CID 126812082) has the molecular formula C18H19N5O2S and a molecular weight of 369.45 g/mol. Its IUPAC name is 2-(benzimidazol-1-yl)-N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethoxy]ethanimidamide.
| Compound Name | 2-(benzimidazol-1-yl)-N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethoxy]ethanimidamide |
|---|---|
| PubChem CID | 126812082 |
| Molecular Formula | C18H19N5O2S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 2-(benzimidazol-1-yl)-N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethoxy]ethanimidamide |
| SMILES | NC(Cn1cnc2ccccc21)=NOCC(=O)N1CCc2sccc2C1 |
| InChI | InChI=1S/C18H19N5O2S/c19-17(10-23-12-20-14-3-1-2-4-15(14)23)21-25-11-18(24)22-7-5-16-13(9-22)6-8-26-16/h1-4,6,8,12H,5,7,9-11H2,(H2,19,21) |
| InChIKey | BQZGKHJJROXTAF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 85.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|