About (4,5-dimethyl-1H-pyrazol-3-yl)methanamine;dihydrochloride
(4,5-dimethyl-1H-pyrazol-3-yl)methanamine;dihydrochloride (PubChem CID 126812233) has the molecular formula C6H13Cl2N3
and a molecular weight of 198.10 g/mol. Its IUPAC name is (4,5-dimethyl-1H-pyrazol-3-yl)methanamine;dihydrochloride.
Molecular Properties
| Compound Name | (4,5-dimethyl-1H-pyrazol-3-yl)methanamine;dihydrochloride |
| PubChem CID | 126812233 |
| Molecular Formula | C6H13Cl2N3 |
| Molecular Weight | 198.10 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | (4,5-dimethyl-1H-pyrazol-3-yl)methanamine;dihydrochloride |
| SMILES | Cc1[nH]nc(CN)c1C.Cl.Cl |
| InChI | InChI=1S/C6H11N3.2ClH/c1-4-5(2)8-9-6(4)3-7;;/h3,7H2,1-2H3,(H,8,9);2*1H |
| InChIKey | MZEPRZMRCWLLSQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.10 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4,5-dimethyl-1H-pyrazol-3-yl)methanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,5-dimethyl-1H-pyrazol-3-yl)methanamine;dihydrochloride?
The IUPAC name of (4,5-dimethyl-1H-pyrazol-3-yl)methanamine;dihydrochloride (CID 126812233) is (4,5-dimethyl-1H-pyrazol-3-yl)methanamine;dihydrochloride.
What is the SMILES notation for (4,5-dimethyl-1H-pyrazol-3-yl)methanamine;dihydrochloride?
The canonical SMILES for (4,5-dimethyl-1H-pyrazol-3-yl)methanamine;dihydrochloride is Cc1[nH]nc(CN)c1C.Cl.Cl.
What is the InChIKey of (4,5-dimethyl-1H-pyrazol-3-yl)methanamine;dihydrochloride?
The InChIKey is MZEPRZMRCWLLSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3.2ClH/c1-4-5(2)8-9-6(4)3-7;;/h3,7H2,1-2H3,(H,8,9);2*1H.
What are the key properties of (4,5-dimethyl-1H-pyrazol-3-yl)methanamine;dihydrochloride?
(4,5-dimethyl-1H-pyrazol-3-yl)methanamine;dihydrochloride has a molecular weight of 198.10 g/mol, XLogP of 1.33, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4,5-dimethyl-1H-pyrazol-3-yl)methanamine;dihydrochloride is sourced from PubChem (CID 126812233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).