About tert-butyl N-(2-amino-2-iminoethyl)-N-methylcarbamate;hydrochloride
tert-butyl N-(2-amino-2-iminoethyl)-N-methylcarbamate;hydrochloride (PubChem CID 126812317) has the molecular formula C8H18ClN3O2
and a molecular weight of 223.70 g/mol. Its IUPAC name is tert-butyl N-(2-amino-2-iminoethyl)-N-methylcarbamate;hydrochloride.
Molecular Properties
| Compound Name | tert-butyl N-(2-amino-2-iminoethyl)-N-methylcarbamate;hydrochloride |
| PubChem CID | 126812317 |
| Molecular Formula | C8H18ClN3O2 |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | tert-butyl N-(2-amino-2-iminoethyl)-N-methylcarbamate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)CN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C8H17N3O2.ClH/c1-8(2,3)13-7(12)11(4)5-6(9)10;/h5H2,1-4H3,(H3,9,10);1H |
| InChIKey | HOMITFIOWFOIRE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-(2-amino-2-iminoethyl)-N-methylcarbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(2-amino-2-iminoethyl)-N-methylcarbamate;hydrochloride?
The IUPAC name of tert-butyl N-(2-amino-2-iminoethyl)-N-methylcarbamate;hydrochloride (CID 126812317) is tert-butyl N-(2-amino-2-iminoethyl)-N-methylcarbamate;hydrochloride.
What is the SMILES notation for tert-butyl N-(2-amino-2-iminoethyl)-N-methylcarbamate;hydrochloride?
The canonical SMILES for tert-butyl N-(2-amino-2-iminoethyl)-N-methylcarbamate;hydrochloride is Cl.[H]/N=C(\N)CN(C)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-(2-amino-2-iminoethyl)-N-methylcarbamate;hydrochloride?
The InChIKey is HOMITFIOWFOIRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O2.ClH/c1-8(2,3)13-7(12)11(4)5-6(9)10;/h5H2,1-4H3,(H3,9,10);1H.
What are the key properties of tert-butyl N-(2-amino-2-iminoethyl)-N-methylcarbamate;hydrochloride?
tert-butyl N-(2-amino-2-iminoethyl)-N-methylcarbamate;hydrochloride has a molecular weight of 223.70 g/mol, XLogP of 1.21, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(2-amino-2-iminoethyl)-N-methylcarbamate;hydrochloride is sourced from PubChem (CID 126812317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).